Methyl 2-iodo-5-methylbenzoate manufacturers
|
| | Methyl 2-iodo-5-methylbenzoate Basic information |
| Product Name: | Methyl 2-iodo-5-methylbenzoate | | Synonyms: | Benzoic acid, 2-iodo-5-methyl-, methyl ester;Methyl 2-iodo-5-Methylbenzoate;Methyl 2-iodo-5-methylbenzoate;2-Iodo-5-methylbenzoic acid methyl ester;Methyl2-iodo-5-methylbenzoate,95%;6-Iodo-m-toluic Acid Methyl Ester;Methyl 6-Iodo-m-toluate;Benzoic acid, 2-iodo-5-methyl-, methyl ester (9CI, ACI) | | CAS: | 103440-52-4 | | MF: | C9H9IO2 | | MW: | 276.07 | | EINECS: | | | Product Categories: | Acids & Esters;Iodine Compounds | | Mol File: | 103440-52-4.mol |  |
| | Methyl 2-iodo-5-methylbenzoate Chemical Properties |
| Boiling point | 105°C/0.6mmHg(lit.) | | density | 1.674 g/mL at 25 °C | | refractive index | n20/D1.596 | | Fp | >110℃ | | storage temp. | 2-8°C | | form | liquid | | Appearance | Light yellow to yellow Liquid | | λmax | 290nm(EtOH)(lit.) | | Sensitive | Light Sensitive | | InChI | InChI=1S/C9H9IO2/c1-6-3-4-8(10)7(5-6)9(11)12-2/h3-5H,1-2H3 | | InChIKey | DHYMLHOXGMUIDZ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(C)=CC=C1I | | CAS DataBase Reference | 103440-52-4 |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2916399090 | | Storage Class | 10 - Combustible liquids |
| | Methyl 2-iodo-5-methylbenzoate Usage And Synthesis |
| | Methyl 2-iodo-5-methylbenzoate Preparation Products And Raw materials |
|