|
|
| | dichlorobis(di-tert-butylphenylphosphine)palladium(II) Basic information |
| Product Name: | dichlorobis(di-tert-butylphenylphosphine)palladium(II) | | Synonyms: | dichlorobis(di-tert-butylphenylphosphine)palladium(II);1,1'-Bis(di-tert-butylphenylphosphino)palladium(II)dichloride;trans-Dichlorobis(di-tert-butylphenylphosphine)palladium(II);pdcl2[p(tBu)2ph]2;Dichlorobis(di-t-butylphenylphosphino)palladium(II);Dichlorobis(di-tert-butylphenylphosphine)palladiuM(II), Pd 17.1%;Palladium,bis[bis(1,1-dimethylethyl)phenylphosphine]dichloro-, (SP-4-1)-;Pd(Phos)Cl2 | | CAS: | 34409-44-4 | | MF: | C28H46Cl2P2Pd | | MW: | 0 | | EINECS: | 681-978-1 | | Product Categories: | Pd | | Mol File: | 34409-44-4.mol |  |
| | dichlorobis(di-tert-butylphenylphosphine)palladium(II) Chemical Properties |
| Melting point | 260-264°C (decomposition) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | colorless to pale-yellow | | Water Solubility | Soluble in water and polar organic solvents. | | Sensitive | Air & moisture sensitive | | InChI | InChI=1S/2C14H23P.2ClH.Pd/c2*1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12;;;/h2*7-11H,1-6H3;2*1H;/q;;;;+2/p-2 | | InChIKey | QNNRAWADYXIGHE-UHFFFAOYSA-L | | SMILES | P(C1C=CC=CC=1)(C(C)(C)C)C(C)(C)C.P(C1C=CC=CC=1)(C(C)(C)C)C(C)(C)C.[Pd](Cl)Cl | | CAS DataBase Reference | 34409-44-4 |
| Safety Statements | 36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | dichlorobis(di-tert-butylphenylphosphine)palladium(II) Usage And Synthesis |
| Chemical Properties | pale yellow-white solid | | Uses | dichlorobis(di-tert-butylphenylphosphine)palladium(II) is used as an effective catalyst for cross-coupling reactions. | | Uses | Dichlorobis(di-tert-butylphenylphosphine)palladium(II) is used as catalyst in Suzuki-Miyaura coupling reactions | | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | dichlorobis(di-tert-butylphenylphosphine)palladium(II) Preparation Products And Raw materials |
|