|
|
| | Benzoic acid, 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester Basic information |
| Product Name: | Benzoic acid, 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester | | Synonyms: | 4-AMino-3-Methoxycarbonylphenylboronic Acid Pinacol Ester;Benzoic acid, 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester;methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;2-AMino-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)benzoic acid Methyl ester;Methyl 2-aMino-5-(tetraMethyl-1,3,2-dioxaborolan-2-yl)benzoate;Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl);benzoic acid, 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester - [B23294];3-methyloxycarbonyl-4-aminobenzeneboronic acidolester | | CAS: | 363185-87-9 | | MF: | C14H20BNO4 | | MW: | 277.12 | | EINECS: | | | Product Categories: | | | Mol File: | 363185-87-9.mol |  |
| | Benzoic acid, 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H20BNO4/c1-13(2)14(3,4)20-15(19-13)9-6-7-11(16)10(8-9)12(17)18-5/h6-8H,16H2,1-5H3 | | InChIKey | DQZPCTKBZUCRNT-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(B2OC(C)(C)C(C)(C)O2)=CC=C1N |
| | Benzoic acid, 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester Usage And Synthesis |
| | Benzoic acid, 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester Preparation Products And Raw materials |
|