|
|
| | 2-Methoxy-4-nitrobenzenesulfonyl chloride Basic information |
| | 2-Methoxy-4-nitrobenzenesulfonyl chloride Chemical Properties |
| Melting point | 90-95 °C (lit.) | | Boiling point | 406.6±35.0 °C(Predicted) | | density | 1.553±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Moisture Sensitive | | BRN | 2136023 | | InChI | 1S/C7H6ClNO5S/c1-14-6-4-5(9(10)11)2-3-7(6)15(8,12)13/h2-4H,1H3 | | InChIKey | QECYXMKYZQXEHM-UHFFFAOYSA-N | | SMILES | COc1cc(ccc1S(Cl)(=O)=O)[N+]([O-])=O | | CAS DataBase Reference | 21320-91-2(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-29-14 | | Safety Statements | 26-36/37/39-45-8 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | HazardClass | IRRITANT, MOISTURE SENSITIVE | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Methoxy-4-nitrobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | Yellow to brown crystalline powder | | Uses | 2-Methoxy-4-nitrobenzenesulfonyl chloride [4-(chlorosulphonyl)-3-methoxynitrobenzene] may be used to synthesize 2-methoxy-4-nitro-N-o-tolyl-benzenesulfonamide. | | General Description | 2-Methoxy-4-nitrobenzenesulfonyl chloride [4-(chlorosulphonyl)-3-methoxynitrobenzene] may be used to synthesize 2-methoxy-4-nitro-N-o-tolyl-benzenesulfonamide. |
| | 2-Methoxy-4-nitrobenzenesulfonyl chloride Preparation Products And Raw materials |
|