| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 400-867-5858;400-867-5858 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:6-Benzoxazolamine, 2-(3-methoxyphenyl)
CAS:1039335-17-5
Purity:97% HPLC Package:5g;25g;100g;1kg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2-(3-Methoxyphenyl)benzo[d]oxazol-6-amine
CAS:1039335-17-5
|
| Company Name: |
Combi-Blocks Inc.
|
| Tel: |
858 635 8950 |
| Email: |
sales@combi-blocks.com |
| Products Intro: |
Product Name:2-(3-Methoxyphenyl)-1,3-benzoxazol-6-amine
CAS:1039335-17-5
|
| Company Name: |
Matrix Scientific
|
| Tel: |
803 788-9494 All other calls |
| Email: |
sales@matrixscientific.com |
| Products Intro: |
Product Name:2-(3-Methoxyphenyl)-1,3-benzoxazol-6-amine
CAS:1039335-17-5
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
- |
| Products Intro: |
Product Name:2-(3-methoxyphenyl)-1,3-benzoxazol-6-amine
|
|
| | 2-(3-methoxyphenyl)-1,3-benzoxazol-6-amine Basic information |
| Product Name: | 2-(3-methoxyphenyl)-1,3-benzoxazol-6-amine | | Synonyms: | 2-(3-methoxyphenyl)-1,3-benzoxazol-6-amine;2-(3-METHOXY-PHENYL)-BENZOOXAZOLE-6-YLAMINE;OTAVA-BB 1315016;2-(3-Methoxyphenyl)benzo[d]oxazol-6-amine;6-Benzoxazolamine, 2-(3-methoxyphenyl);2-(3-Methoxyphenyl)benzo[d]oxazol-6-amine | | CAS: | 1039335-17-5 | | MF: | C14H12N2O2 | | MW: | 240.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1039335-17-5.mol |  |
| | 2-(3-methoxyphenyl)-1,3-benzoxazol-6-amine Chemical Properties |
| Melting point | 212-219 °C | | Boiling point | 411.9±25.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | pka | 2.32±0.10(Predicted) | | form | solid | | InChI | 1S/C14H12N2O2/c1-17-11-4-2-3-9(7-11)14-16-12-6-5-10(15)8-13(12)18-14/h2-8H,15H2,1H3 | | InChIKey | MQXWPPVVKWYMEZ-UHFFFAOYSA-N | | SMILES | NC1=CC2=C(C=C1)N=C(C3=CC=CC(OC)=C3)O2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 2-(3-methoxyphenyl)-1,3-benzoxazol-6-amine Usage And Synthesis |
| | 2-(3-methoxyphenyl)-1,3-benzoxazol-6-amine Preparation Products And Raw materials |
|