- L-4FPG
-
- $29.00
-
2026-05-11
- CAS:19883-57-9
- Purity: 99.26%
- Supply Ability: 10g
|
| | (S)-4-Fluorophenylglycine Basic information |
| | (S)-4-Fluorophenylglycine Chemical Properties |
| Melting point | ≥300 °C | | alpha | 138 º (c=1%,1N HCl) | | Boiling point | 289.9±30.0 °C(Predicted) | | density | 1.2345 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in 1M HCl. | | form | Solid | | pka | 1.90±0.10(Predicted) | | color | White to off-white | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C8H8FNO2/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/s3 | | InChIKey | JKFYKCYQEWQPTM-KPOCXSGKNA-N | | SMILES | [C@@H](N)(C(=O)O)C1=CC=C(F)C=C1 |&1:0,r| | | CAS DataBase Reference | 19883-57-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29224999 |
| | (S)-4-Fluorophenylglycine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | An optically active amino acid derivative as intermediate for making drugs. | | Uses | 4-Fluoro-L-phenylglycine is an optically active amino acid derivative that is used as an intermediate for making drugs. |
| | (S)-4-Fluorophenylglycine Preparation Products And Raw materials |
|