|
|
| | Heptadecafluorooctanesulfonic acid tetraethylammonium salt Basic information |
| Product Name: | Heptadecafluorooctanesulfonic acid tetraethylammonium salt | | Synonyms: | PERFLUORO-1-OCTANESULFONIC ACID, TETRAETHYLAMMONIUM SALT;PERFLUOROOCTANESULFONIC ACID TETRAETHYLAMMONIUM SALT;TETRAETHYLAMMONIUM PERFLUOROOCTANESULFONATE;TETRAETHYLAMMONIUM PERFLUOROOCTANESULPHONATE;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctane-1-sulfonate·tetraethylaminium;Heptadecafluorooctane-1-sulfonate·tetraethylaminium;Tetraethylaminium·1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;Tetraethylaminium·heptadecafluorooctane-1-sulfonate | | CAS: | 56773-42-3 | | MF: | C16H20F17NO3S | | MW: | 629.37 | | EINECS: | 260-375-3 | | Product Categories: | Organics | | Mol File: | 56773-42-3.mol |  |
| | Heptadecafluorooctanesulfonic acid tetraethylammonium salt Chemical Properties |
| Melting point | 184-190 °C(lit.) | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | 533g/L at 20℃ | | BRN | 6470030 | | Stability: | Hygroscopic | | InChI | 1S/C8HF17O3S.C8H20N/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28;1-5-9(6-2,7-3)8-4/h(H,26,27,28);5-8H2,1-4H3/q;+1/p-1 | | InChIKey | JHDXAQHGAJXNBY-UHFFFAOYSA-M | | SMILES | CC[N+](CC)(CC)CC.[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 56773-42-3(CAS DataBase Reference) | | EPA Substance Registry System | Ethanaminium, N,N,N-triethyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonic acid (1:1) (56773-42-3) |
| Hazard Codes | T | | Risk Statements | 25-64-48/25-40-20-61 | | Safety Statements | 45-28-36/37-53 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 2 | | RTECS | KH3154250 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Inhalation
Aquatic Chronic 3
Carc. 2
Lact.
Repr. 1B
STOT RE 1 |
| | Heptadecafluorooctanesulfonic acid tetraethylammonium salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Heptadecafluorooctanesulfonic acid tetraethylammonium salt (CAS# 56773-42-3) is a surfactant used in the electroplating process of various metals, such as chromium and nickel. Heptadecafluorooctanesulfonic acid tetraethylammonium salt is an environmental pollutant, and has been detected in processed foods. | | Hazard | A poison by ingestion. |
| | Heptadecafluorooctanesulfonic acid tetraethylammonium salt Preparation Products And Raw materials |
|