- 2-N-BUTYLPROPANE-1,3-DIOL
-
- $15.00 / 1KG
-
2021-08-12
- CAS:2612-26-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2-N-BUTYLPROPANE-1,3-DIOL Basic information |
| | 2-N-BUTYLPROPANE-1,3-DIOL Chemical Properties |
| Boiling point | 102-107 °C(Press: 5 Torr) | | density | 0.947±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.51±0.10(Predicted) | | Appearance | Colorless to light yellow Viscous Liquid | | InChI | InChI=1S/C7H16O2/c1-2-3-4-7(5-8)6-9/h7-9H,2-6H2,1H3 | | InChIKey | SIMYRXPCIUXDGR-UHFFFAOYSA-N | | SMILES | C(O)C(CCCC)CO | | CAS DataBase Reference | 2612-26-2(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-N-BUTYLPROPANE-1,3-DIOL Usage And Synthesis |
| | 2-N-BUTYLPROPANE-1,3-DIOL Preparation Products And Raw materials |
|