|
|
| | DIMEPIPERATE Basic information |
| Product Name: | DIMEPIPERATE | | Synonyms: | DIMEPIPERATE;1-piperidinecarbothioicacid,s-(1-methyl-1-phenylethyl)ester;muw1193;my93;s-1-methyl-1-phenylethylpiperidine1-carbothioate;YUKAMATE;S-(1-methyl-1-phenylethyl)-1-piperidinecarbothioate;Dimepiperate solution | | CAS: | 61432-55-1 | | MF: | C15H21NOS | | MW: | 263.4 | | EINECS: | 262-784-2 | | Product Categories: | | | Mol File: | 61432-55-1.mol |  |
| | DIMEPIPERATE Chemical Properties |
| Melting point | 39℃ | | Boiling point | 166 °C | | density | 1.0766 (rough estimate) | | refractive index | 1.7500 (estimate) | | storage temp. | 0-6°C | | pka | -1.24±0.20(Predicted) | | Henry's Law Constant | 2.8×102 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C15H21NOS/c1-15(2,13-9-5-3-6-10-13)18-14(17)16-11-7-4-8-12-16/h3,5-6,9-10H,4,7-8,11-12H2,1-2H3 | | InChIKey | BWUPSGJXXPATLU-UHFFFAOYSA-N | | SMILES | CC(C)(SC(=O)N1CCCCC1)c2ccccc2 |
| Hazard Codes | Xn,N | | Risk Statements | 22-51/53 | | Safety Statements | 61 | | RIDADR | UN3082 9/PG 3 | | WGK Germany | 3 | | RTECS | TM5958000 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2 |
| | DIMEPIPERATE Usage And Synthesis |
| Chemical Properties | Appearance like a waxy solid. mp38.8～39.3℃, bp164～168℃/99.75Pa, vapor pressure 0.53×10-3Pa (30℃), relative density 1.08 (25℃). | | Uses | Dimepiperate is a systemic conduction type selective paddy herbicide. | | Definition | ChEBI: Dimepiperate is a monothiocarbamic ester and a piperidinecarboxylate ester. |
| | DIMEPIPERATE Preparation Products And Raw materials |
|