|
|
| | N2-ETHYL-2'-DEOXYGUANOSINE Basic information |
| | N2-ETHYL-2'-DEOXYGUANOSINE Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: >5mg/mL | | form | solid | | color | white to off-white | | Water Solubility | H2O: >5mg/mL | | InChI | 1S/C12H17N5O4/c1-2-13-12-15-10-9(11(20)16-12)14-5-17(10)8-3-6(19)7(4-18)21-8/h5-8,18-19H,2-4H2,1H3,(H2,13,15,16,20)/t6-,7+,8+/m0/s1 | | InChIKey | VOKQFDULHQUWAV-XLPZGREQSA-N | | SMILES | CCNC1=Nc2c(ncn2[C@H]3C[C@H](O)[C@@H](CO)O3)C(=O)N1 |
| Hazard Codes | T+ | | Risk Statements | 26/27/28-33-40 | | Safety Statements | 36/37/39-45 | | RIDADR | UN 2811 6.1 / PGI | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Carc. 2 STOT RE 2 |
| | N2-ETHYL-2'-DEOXYGUANOSINE Usage And Synthesis |
| Uses | 2'-Deoxy-N-ethylguanosine is a acetaldehyde derived DNA adduct formed in human leukocyte DNA of healthy individuals following alcohol consumption. |
| | N2-ETHYL-2'-DEOXYGUANOSINE Preparation Products And Raw materials |
|