|
|
| | N2-Ethyl-2'-deoxyguanosine Basic information |
| Product Name: | N2-Ethyl-2'-deoxyguanosine | | Synonyms: | N2-Et-dG;2-(ethylamino)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one;2-(Ethylamino)-9-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-purin-6(9H)-one;Guanosine, 2'-deoxy-N-ethyl-;Guanosine,2'-deoxy-N-ethyl-;N2-Ethyl-2’-deoxy guanosine;N2-Ethyl-2′-deoxyguanosine - 98 % HPLC;(2,4-Dimethyl-phenoxy)-acetic acid [5-(3-chloro-4-methyl-phenyl)-furan-2-ylmethylene]-hydrazide | | CAS: | 101803-03-6 | | MF: | C12H17N5O4 | | MW: | 295.29 | | EINECS: | | | Product Categories: | Mutagenesis Research Chemicals, Nucleotides, Bases & Related Reagents | | Mol File: | 101803-03-6.mol |  |
| | N2-Ethyl-2'-deoxyguanosine Chemical Properties |
| Melting point | 240-242 °C (decomp) | | density | 1.764±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | solubility | H2O: >5mg/mL | | form | solid | | pka | 10.620±0.10(predicted) | | color | white to off-white | | Water Solubility | H2O: >5mg/mL | | InChI | 1S/C12H17N5O4/c1-2-13-12-15-10-9(11(20)16-12)14-5-17(10)8-3-6(19)7(4-18)21-8/h5-8,18-19H,2-4H2,1H3,(H2,13,15,16,20)/t6-,7+,8+/m0/s1 | | InChIKey | VOKQFDULHQUWAV-XLPZGREQSA-N | | SMILES | CCNC1=Nc2c(ncn2[C@H]3C[C@H](O)[C@@H](CO)O3)C(=O)N1 |
| Hazard Codes | T+ | | Risk Statements | 26/27/28-33-40 | | Safety Statements | 36/37/39-45 | | RIDADR | UN 2811 6.1 / PGI | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Dermal
Acute Tox. 2 Inhalation
Acute Tox. 2 Oral
Carc. 2
STOT RE 2 |
| | N2-Ethyl-2'-deoxyguanosine Usage And Synthesis |
| Uses | 2'-Deoxy-N-ethylguanosine is a acetaldehyde derived DNA adduct formed in human leukocyte DNA of healthy individuals following alcohol consumption. |
| | N2-Ethyl-2'-deoxyguanosine Preparation Products And Raw materials |
|