|
|
| | (S)-3-HYDROXYBUTYRIC ACID Basic information |
| | (S)-3-HYDROXYBUTYRIC ACID Chemical Properties |
| Melting point | 45-48 °C | | alpha | 25 º (C=6% IN H2O) | | Boiling point | 269.2±0.0 °C(Predicted) | | density | 1.195±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 4.36±0.10(Predicted) | | form | solid | | color | White | | Optical Rotation | [α]20/D +25±1°, c = 6% in H2O | | Water Solubility | Water : 50 mg/mL (480.31 mM) | | BRN | 1720567 | | InChI | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1 | | InChIKey | WHBMMWSBFZVSSR-VKHMYHEASA-N | | SMILES | C(O)(=O)C[C@@H](O)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-3-HYDROXYBUTYRIC ACID Usage And Synthesis |
| Uses | (S)-3-Hydroxybutanoic acid is a metabolite and a disease marker of depression. 3-Hydroxybutyric acid is synthesized in the liver from acetyl-CoA, and can be used as an energy source by the brain when blood glucose is low. | | Definition | ChEBI: The S-enantiomer of 3-hydroxybutyric acid; a normal human metabolite, that has been found elevated in geriatric patients remitting from depression. | | IC 50 | Human Endogenous Metabolite | | storage | Room temperature | | References | [1] Khouri H, et al., Acetoacetate and d- and l-β-hydroxybutyrate have distinct effects on basal and insulin-stimulated glucose uptake in L6 skeletal muscle cells. Am J Physiol Cell Physiol. 2024 Jun 1;326(6):C1710-C1720. DOI:10.1152/ajpcell.00718.2023 |
| | (S)-3-HYDROXYBUTYRIC ACID Preparation Products And Raw materials |
|