- 4-Propionamidophenol
-
- $57.00 / 200mg
-
2026-05-11
- CAS:1693-37-4
- Min. Order:
- Purity: 99.79%
- Supply Ability: 10g
- parapropamol
-
- $1.00 / 1KG
-
2019-07-06
- CAS:1693-37-4
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200kg
|
| | ACETAMINOPHEN IMPURITY B Basic information |
| | ACETAMINOPHEN IMPURITY B Chemical Properties |
| Melting point | 170-172°C | | Boiling point | 389.9±25.0 °C(Predicted) | | density | 1.201 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 10.11±0.26(Predicted) | | form | Solid | | color | White to Pale Purple | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C9H11NO2/c1-2-9(12)10-7-3-5-8(11)6-4-7/h3-6,11H,2H2,1H3,(H,10,12) | | InChIKey | SSMYTAQHMUHRSK-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(O)C=C1)(=O)CC | | CAS DataBase Reference | 1693-37-4 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | ACETAMINOPHEN IMPURITY B Usage And Synthesis |
| Chemical Properties | Pale Purple Solid | | Uses | An Acetaminophen (A161220) impurity. | | Uses | 4-Propionamidophenol (Acetaminophen Impurity B) is an impurity of Acetaminophen (A161220) (1). Acetaminophen is an analgesic and antipyretic agent and used as a pain reliever to treat headache, muscle aches, and arthritis (2,3). |
| | ACETAMINOPHEN IMPURITY B Preparation Products And Raw materials |
|