|
|
| | Tris[3-(trimethoxysilyl)propyl] Isocyanurate Basic information |
| Product Name: | Tris[3-(trimethoxysilyl)propyl] Isocyanurate | | Synonyms: | tris((trimethoxysilyl)propyl)isocyanurate;TRIS(3-(TRIMETHOXYSILYL)PROPYL) ISO-CYAN URATE, TECH.;TRIS(3-TRIMETHOXYSILYLPROPYL)ISOCYANURATE 95%;1,3,5-Tris(trimethoxysilylpropyl)isocyanurate;1,3,5-TRIS[3-(TRIMETHOXYSILYL)PROPYL]-1,3,5-TRIAZINE-2,4,6-TRIONE;tris(trimethoxysilylpropyl)-s-triazine-2,4,6-trione;1,3,5-Tris[3-(trimethoxysilyl)propyl]hexahydro-1,3,5-triazine-2,4,6-trione;3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-tris[3-(trimethoxysilyl)propyl]-1 | | CAS: | 26115-70-8 | | MF: | C21H45N3O12Si3 | | MW: | 615.85 | | EINECS: | 247-465-8 | | Product Categories: | Organosilicon;Self Assembly&Contact Printing;Self-Assembly Materials;SilanesOrganometallic Reagents;Trialkoxysilanes;Chemical Synthesis;Contact Printing;Materials Science;Micro/NanoElectronics;Organometallic Reagents;Self Assembly &;Self-Assembly Materials;Silanes | | Mol File: | 26115-70-8.mol | ![Tris[3-(trimethoxysilyl)propyl] Isocyanurate Structure](CAS/GIF/26115-70-8.gif) |
| | Tris[3-(trimethoxysilyl)propyl] Isocyanurate Chemical Properties |
| Melting point | <0°C | | Boiling point | 250 °C(lit.) | | density | 1.17 g/mL at 25 °C(lit.) | | vapor pressure | 0-12790Pa at 20-25℃ | | refractive index | n20/D 1.461(lit.) | | Fp | 216 °F | | pka | -2.17±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.170 | | Water Solubility | 14-1000000000μg/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C21H45N3O12Si3/c1-28-37(29-2,30-3)16-10-13-22-19(25)23(14-11-17-38(31-4,32-5)33-6)21(27)24(20(22)26)15-12-18-39(34-7,35-8)36-9/h10-18H2,1-9H3 | | InChIKey | QWOVEJBDMKHZQK-UHFFFAOYSA-N | | SMILES | CO[Si](CCCN1C(=O)N(CCC[Si](OC)(OC)OC)C(=O)N(CCC[Si](OC)(OC)OC)C1=O)(OC)OC | | LogP | -4-2.4 at 20℃ | | CAS DataBase Reference | 26115-70-8 | | EPA Substance Registry System | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris[3-(trimethoxysilyl)propyl]- (26115-70-8) |
| Hazard Codes | T | | Risk Statements | 23/25-36/38-68/20/21/22-42-21 | | Safety Statements | 26-45-36/37-35-23 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | RTECS | XZ2025000 | | TSCA | TSCA listed | | HS Code | 29336990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Tris[3-(trimethoxysilyl)propyl] Isocyanurate Usage And Synthesis |
| Uses | Adhesion promoter and cross-linking agent.Improves adhesion to PVC and a variety of substrates. | | Uses | Tris[3-(trimethoxysilyl)propyl] Isocyanurate is a cross-linking agent and an adhesion promoter that improves adhesion to PVS and variety of substrates. | | Uses | Tris[3-(trimethoxysilyl)propyl] isocyanurate (TTPI) can be used in the preparation of:
- Pd nanoparticle and single-walled carbon nanotube hybrid materials.
- Periodic mesoporous organosilicas exhibiting absorption properties for heavy metal ions like mercury.
- Mesoporous organosilicaaluminacomposites with an affinity for CO2gas at elevated temperatures.
- Isocyanurate-containing ordered mesoporous organosilicas using block copolymer.
| | Flammability and Explosibility | Not classified |
| | Tris[3-(trimethoxysilyl)propyl] Isocyanurate Preparation Products And Raw materials |
|