5,12-NAPHTHACENEQUINONE manufacturers
|
| | 5,12-NAPHTHACENEQUINONE Basic information |
| Product Name: | 5,12-NAPHTHACENEQUINONE | | Synonyms: | 5,12-NAPHTHACENEDIONE;5,12-NAPHTHACENEQUINONE;2,3-BENZANTHRACHINON;2,3-BENZANTHRAQUINONE;2,3-BENZO-9,10-ANTHRAQUINONE;5,12-Tetracenequinone;naphthacene-5,12-dione;Naphthacene-6,11-quinone | | CAS: | 1090-13-7 | | MF: | C18H10O2 | | MW: | 258.27 | | EINECS: | 214-127-6 | | Product Categories: | C15 to C38;Carbonyl Compounds;Ketones | | Mol File: | 1090-13-7.mol |  |
| | 5,12-NAPHTHACENEQUINONE Chemical Properties |
| Melting point | 282-286 °C (dec.) (lit.) | | Boiling point | 361.53°C (rough estimate) | | density | 1.1584 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly, Heated), DMF (Slightly, Heated), DMSO (Slightly, Heated) | | form | Solid | | color | Light Yellow to Yellow | | BRN | 1880180 | | InChI | InChI=1S/C18H10O2/c19-17-13-7-3-4-8-14(13)18(20)16-10-12-6-2-1-5-11(12)9-15(16)17/h1-10H | | InChIKey | LZPBKINTWROMEA-UHFFFAOYSA-N | | SMILES | C1=C2C(C(=O)C3=C(C2=O)C=C2C(C=CC=C2)=C3)=CC=C1 | | CAS DataBase Reference | 1090-13-7 | | EPA Substance Registry System | 5,12-Naphthacenedione (1090-13-7) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29146990 | | Storage Class | 11 - Combustible Solids |
| | 5,12-NAPHTHACENEQUINONE Usage And Synthesis |
| Chemical Properties | Khaki powder | | Uses | 5,12-Naphthacenequinone was used to study the phototransformation of phenol in aqueous solution. | | Definition | ChEBI: Tetracene-5,12-dione is a tetracenequinone. | | General Description | The electronic structure of the lowest excited triplet state of 5,12-naphthacenequinone was studied using pulsed electron nuclear double resonance and continuous-wave time-resolved EPR (cw-TREPR). |
| | 5,12-NAPHTHACENEQUINONE Preparation Products And Raw materials |
|