| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole Basic information |
| Product Name: | 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole | | Synonyms: | 1-(2-Tetrahydropyranyl)-1H-pyrazole;1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole;1-(2-Tetrahydropyranyl)pyrazole;1-(Tetrahydro-pyran-2-yl)-1H-pyrazole;1-(2-Tetrahydropyranyl)-1H-pyrazole 95%;1-(2-Tetrahydropyranyl);1H-Pyrazole,1-(tetrahydro-2H-pyran-2-yl)-;1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole 97% | | CAS: | 449758-17-2 | | MF: | C8H12N2O | | MW: | 152.19 | | EINECS: | | | Product Categories: | | | Mol File: | 449758-17-2.mol |  |
| | 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole Chemical Properties |
| Boiling point | 269.8±33.0℃ (760 Torr) | | density | 1.084 g/mL at 25 °C | | refractive index | n20/D 1.503 | | Fp | 104 °C | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | pka | 2.08±0.19(Predicted) | | color | Colorless to pale yellow | | InChI | InChI=1S/C8H12N2O/c1-2-7-11-8(4-1)10-6-3-5-9-10/h3,5-6,8H,1-2,4,7H2 | | InChIKey | IMZWSOSYNFVECD-UHFFFAOYSA-N | | SMILES | N1(C2OCCCC2)C=CC=N1 | | CAS DataBase Reference | 449758-17-2 |
| WGK Germany | 3 | | HS Code | 2933199090 | | Storage Class | 10 - Combustible liquids |
| | 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole Usage And Synthesis |
| Uses | 1-THP-protected 1H-pyrazole as the valuable starter for the preparation of pyrazolylboronic ester, which is useful in the synthesis of pyrazoloisoindoles and other pyrazole derivatives | | Synthesis | General procedure for the synthesis of 1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole from 3,4-dihydro-2H-pyran and pyrazole: cf. Example 1 [1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]boronic acid. Pyrazole (14.3 g, 0.21 mol) was mixed with 3,4-dihydro-2H-pyran (29 mL, 0.32 mol) and trifluoroacetic acid (0.1 mL, 0.0013 mol) and heated under reflux conditions for 5 hours. Upon completion of the reaction, the mixture was cooled to room temperature, followed by the addition of sodium hydride (60% dispersed in mineral oil, 0.2 g, 0.008 mol) and stirred for 10 min. Finally, the reaction mixture was purified by reduced pressure distillation (60-65 °C, 0.5-1 mmHg) to afford the target product 1-(tetrahydropyran-2-yl)-1H-pyrazole (30.8 g, 96% yield). | | References | [1] Tetrahedron Letters, 2006, vol. 47, # 27, p. 4665 - 4669
[2] Tetrahedron Letters, 2007, vol. 48, # 23, p. 4123 - 4126
[3] Journal of Organic Chemistry, 2016, vol. 81, # 4, p. 1718 - 1722
[4] Patent: WO2017/66606, 2017, A1. Location in patent: Page/Page column 49
[5] Patent: WO2007/138072, 2007, A2. Location in patent: Page/Page column 54 |
| | 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole Preparation Products And Raw materials |
|