| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Bromoacetic acid-13C2,d3 Basic information |
| | Bromoacetic acid-13C2,d3 Chemical Properties |
| Melting point | 47-49 °C(lit.) | | Boiling point | 208 °C(lit.) | | form | solid | | InChI | 1S/C2H3BrO2/c3-1-2(4)5/h1H2,(H,4,5)/i1+1D2,2+1/hD | | InChIKey | KDPAWGWELVVRCH-GLDNNCGESA-N | | SMILES | [2H]O[13C](=O)[13C]([2H])([2H])Br |
| Hazard Codes | T,C,N | | Risk Statements | 23/24/25-35-50-43 | | Safety Statements | 26-36/37/39-45-61 | | RIDADR | UN 3425 8/PG 2 | | WGK Germany | 2 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1A |
| | Bromoacetic acid-13C2,d3 Usage And Synthesis |
| Uses | 2-Bromoacetic-1,2-13C2-2,2-d2 Acid-d is a labeled Bromoacetic Acid (B679075). Bromoacetic Acid is a relatively strong alkylating agent as well as a versatile building block used very commonly in organic synthesis. Bromoacetic acid has been shown to reversibly inhibit human erythrocyte carbonic anhydrase B. |
| | Bromoacetic acid-13C2,d3 Preparation Products And Raw materials |
|