| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Phenylboronic acid MIDA ester
CAS:109737-57-7
Purity:95% Package:1G,5G
|
|
| | 6-Methyl-2-phenyl-1,3,6,2-dioxazaborocane-4,8-dione Basic information |
| Product Name: | 6-Methyl-2-phenyl-1,3,6,2-dioxazaborocane-4,8-dione | | Synonyms: | 6-Methyl-2-phenyl-1,3,6,2-dioxazaborocane-4,8-dione;Phenylboronic acid MIDA ester;Phenylboronic acid MIDA ester 95%;2-Phenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione;Benzeneboronic acid methyliminodiacetic acid ester | | CAS: | 109737-57-7 | | MF: | C11H12BNO4 | | MW: | 233.02828 | | EINECS: | | | Product Categories: | | | Mol File: | 109737-57-7.mol |  |
| | 6-Methyl-2-phenyl-1,3,6,2-dioxazaborocane-4,8-dione Chemical Properties |
| Melting point | 166-170 °C | | form | powder | | InChI | 1S/C11H12BNO4/c1-13-7-10(14)16-12(17-11(15)8-13)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 | | InChIKey | AISHCGVNWMRLOM-UHFFFAOYSA-N | | SMILES | CN1CC(=O)OB(OC(=O)C1)c2ccccc2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 6-Methyl-2-phenyl-1,3,6,2-dioxazaborocane-4,8-dione Usage And Synthesis |
| | 6-Methyl-2-phenyl-1,3,6,2-dioxazaborocane-4,8-dione Preparation Products And Raw materials |
|