|
|
| | 4-Nonylphenol-2,3,5,6-d4 Basic information |
| Product Name: | 4-Nonylphenol-2,3,5,6-d4 | | Synonyms: | 4-Nonylphenol-2,3,5,6-d4;2,3,5,6-tetradeuterio-4-nonylphenol;4-n-Nonylphenol D4 (phenyl D4) 100 μg/mL in Acetone;4-Nonylphenol-d4;4-Nonylphenol-2,3,5,6-d4 | | CAS: | 1173019-62-9 | | MF: | C15H24O | | MW: | 220.36 | | EINECS: | | | Product Categories: | Alphabetical Listings;N-O;Stable Isotopes | | Mol File: | 1173019-62-9.mol |  |
| | 4-Nonylphenol-2,3,5,6-d4 Chemical Properties |
| Boiling point | 293-297(lit.) | | density | 0.957 g/mL | | Fp | 113 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | color | White to Off-White | | InChI | 1S/C15H24O/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3/i10D,11D,12D,13D | | InChIKey | IGFHQQFPSIBGKE-ZGAVCIBUSA-N | | SMILES | [2H]c1c([2H])c(CCCCCCCCC)c([2H])c([2H])c1O |
| Hazard Codes | C,N | | Risk Statements | 22-34-50/53-62-63 | | Safety Statements | 26-36/37/39-45-60-61-46 | | RIDADR | UN 2430 8/PG 2 | | WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Dam. 1
Repr. 2
Skin Corr. 1B |
| | 4-Nonylphenol-2,3,5,6-d4 Usage And Synthesis |
| Uses | 4-n-Nonylphenol-2,3,5,6-d4 is the labelled isotope compound of 4-Nonyl Phenol(N650430) which is used in the process for the manufacture of 5-nonyl salicylaldoxime, which is used for the selective purification and concentration of copper ions. |
| | 4-Nonylphenol-2,3,5,6-d4 Preparation Products And Raw materials |
|