|
|
| | 4-ethyl-2-methyl-1,3-thiazole-5-carboxylic acid Basic information | | Application |
| Product Name: | 4-ethyl-2-methyl-1,3-thiazole-5-carboxylic acid | | Synonyms: | 4-ethyl-2-methyl-1,3-thiazole-5-carboxylic acid;4-ethyl-2-methyl-1,3-thiazole-5-carboxylic acid(SALTDATA: FREE);4-ethyl-2-methyl-5-thiazolecarboxylic acid;4-Ethyl-2-Methylthiazole-5-carboxylic acid;5-Thiazolecarboxylic acid, 4-ethyl-2-methyl- | | CAS: | 119778-44-8 | | MF: | C7H9NO2S | | MW: | 171.22 | | EINECS: | | | Product Categories: | | | Mol File: | 119778-44-8.mol |  |
| | 4-ethyl-2-methyl-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Boiling point | 299.6±20.0 °C(Predicted) | | density | 1.280±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 1.24±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C7H9NO2S/c1-3-5-6(7(9)10)11-4(2)8-5/h3H2,1-2H3,(H,9,10) | | InChIKey | VANMGYYUWZXKPW-UHFFFAOYSA-N | | SMILES | S1C(C(O)=O)=C(CC)N=C1C |
| HazardClass | IRRITANT | | HS Code | 2934100090 |
| | 4-ethyl-2-methyl-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| Application | 2-Methyl-4-ethyl-5-thiazolic acid can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical and pharmaceutical production processes. |
| | 4-ethyl-2-methyl-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|