|
|
| | 2-Methyl-5-nitrobenzenesulfonyl chloride Basic information |
| | 2-Methyl-5-nitrobenzenesulfonyl chloride Chemical Properties |
| Melting point | 41-45 °C | | Boiling point | 135-137 °C/0.7 mmHg | | density | 1.4103 (rough estimate) | | refractive index | 1.6000 (estimate) | | Fp | 135-137°C/0.7mm | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Moisture Sensitive | | BRN | 2697079 | | InChI | 1S/C7H6ClNO4S/c1-5-2-3-6(9(10)11)4-7(5)14(8,12)13/h2-4H,1H3 | | InChIKey | WPGVQDHXOUAJBW-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1S(Cl)(=O)=O)[N+]([O-])=O | | CAS DataBase Reference | 121-02-8(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-29-34 | | Safety Statements | 22-26-30-45-8-36/37/39 | | RIDADR | 3261 | | WGK Germany | 3 | | RTECS | XT8000000 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Methyl-5-nitrobenzenesulfonyl chloride Usage And Synthesis |
| Uses | Intermediate in the preparation of PDE7 inhibitors and kinase inhibitors. | | Synthesis | Add 6.90 g (0.05 mol) of p-nitrotoluene to a 100 mL three-necked flask, slowly add 17.5 g (0.15 mol) of chlorosulfonic acid dropwise with vigorous stirring, and after dropping, warm up the reaction to 65??C for 24 h. After the reaction, the reaction solution was slowly poured into 100 mL of iced water, and then extracted with dichloromethane (100 mL??2), and the organic layers were combined to obtain 2-methyl-5-nitrobenzenesulfonyl chloride. The organic layer was extracted with dichloromethane (100 mL??2). |
| | 2-Methyl-5-nitrobenzenesulfonyl chloride Preparation Products And Raw materials |
|