|
|
| | N,N'-Bis(4-chlorophenyl)thiourea Basic information |
| Product Name: | N,N'-Bis(4-chlorophenyl)thiourea | | Synonyms: | 1,3-Bis(4-chlorophenyl)thiourea;1,3-Bis(p-chlorophenyl)thiourea;N,N'-Bis(4-chlorophenyl)thiourea;1,3-BIS(4-CHLOROPHENYL)-2-THIOUREA;Thiourea,N,N'-bis(4-chlorophenyl)-;1,3-Bis(4-chlorophenyl)thiourea >;DI-P-CHLOROPHENYLTHIOUREA;1,3-Bis(4-chlorophenyl)thiourea - [B94362] | | CAS: | 1220-00-4 | | MF: | C13H10Cl2N2S | | MW: | 297.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1220-00-4.mol |  |
| | N,N'-Bis(4-chlorophenyl)thiourea Chemical Properties |
| Melting point | 169.0 to 173.0 °C | | Boiling point | 401.0±55.0 °C(Predicted) | | density | 1.474±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 11.53±0.70(Predicted) | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C13H10Cl2N2S/c14-9-1-5-11(6-2-9)16-13(18)17-12-7-3-10(15)4-8-12/h1-8H,(H2,16,17,18) | | InChIKey | SYJZYFOTCABQES-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(Cl)C=C1)C(NC1=CC=C(Cl)C=C1)=S | | CAS DataBase Reference | 1220-00-4 |
| | N,N'-Bis(4-chlorophenyl)thiourea Usage And Synthesis |
| Uses | 1,3-Bis(4-chlorophenyl)thiourea is used as a reactant in the preparation of thiohydantoins via solventless cyclocondensation of arylthioureas with chloroacetyl chloride over K2CO3. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 34, p. 1408, 1956 DOI: 10.1139/v56-180 |
| | N,N'-Bis(4-chlorophenyl)thiourea Preparation Products And Raw materials |
|