- 6-Hydroxy-1-naphthoic acid
-
- $5.00 / 1KG
-
2025-09-25
- CAS:2437-17-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 6-Hydroxy-1-naphthoic acid Basic information | | Application |
| | 6-Hydroxy-1-naphthoic acid Chemical Properties |
| Melting point | 210°C | | Boiling point | 445.7±18.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.76±0.10(Predicted) | | color | White to Brown | | InChI | InChI=1S/C11H8O3/c12-8-4-5-9-7(6-8)2-1-3-10(9)11(13)14/h1-6,12H,(H,13,14) | | InChIKey | JCJUKCIXTRWAQY-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=C2C(C=C(O)C=C2)=CC=C1 | | CAS DataBase Reference | 2437-17-4(CAS DataBase Reference) |
| | 6-Hydroxy-1-naphthoic acid Usage And Synthesis |
| Application | 6-Hydroxy-1-naphthoic acid can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. | | Chemical Properties | White to light yellow crystal powder. 6-Hydroxy-1-naphthoic acid [2437-17-4], mp 213℃, is produced by hydrolysis (10 % KOH) and potassium hydroxide fusion (260℃) of 1-cyanonaphthalene-6-sulfonic acid (from 1- aminonaphthalene-6-sulfonic acid and cyanoSandmeyer reaction). |
| | 6-Hydroxy-1-naphthoic acid Preparation Products And Raw materials |
|