|
|
| | 3-AMINO-5-METHYL-4H-1,2,4-TRIAZOLE Basic information | | Uses |
| Product Name: | 3-AMINO-5-METHYL-4H-1,2,4-TRIAZOLE | | Synonyms: | 5-METHYL-4H-1,2,4-TRIAZOL-3-AMINE;5-METHYL-4H-[1,2,4]TRIAZOL-3-YLAMINE;(5-METHYL-4H-1,2,4-TRIAZOLE-3-YL)AMINE;3-AMINO-5-METHYL-4H-1,2,4-TRIAZOLE;3-AMINO-5-METHYL-1,2,4-TRIAZOLE;5-Methyl-1H-[1,2,4]triazol-3-ylaMine;1H-1,2,4-triazol-3-aMine, 5-Methyl-;5-Methyl-4H-1,2,4-triazol-3-ylamine hydrochloride | | CAS: | 4923-01-7 | | MF: | C3H6N4 | | MW: | 98.11 | | EINECS: | | | Product Categories: | | | Mol File: | 4923-01-7.mol |  |
| | 3-AMINO-5-METHYL-4H-1,2,4-TRIAZOLE Chemical Properties |
| Melting point | 142-144 | | Boiling point | 345.5±25.0 °C(Predicted) | | density | 1.348±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 11.56±0.40(Predicted) | | color | Pale yellow | | InChI | InChI=1S/C3H6N4/c1-2-5-3(4)7-6-2/h1H3,(H3,4,5,6,7) | | InChIKey | FJRZOOICEHBAED-UHFFFAOYSA-N | | SMILES | N1C(N)=NC(C)=N1 | | CAS DataBase Reference | 4923-01-7(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-22 | | Safety Statements | 22-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-AMINO-5-METHYL-4H-1,2,4-TRIAZOLE Usage And Synthesis |
| Uses | 3-Amino-5-methyl-4H-1,2,4-triazole can be used as a pharmaceutical and chemical synthesis intermediate. If 3-amino-5-methyl-4H-1,2,4-triazole is inhaled, move the patient to fresh air; if skin contact occurs, remove contaminated clothing and thoroughly wash the skin with soap and water. If discomfort persists, seek medical attention. |
| | 3-AMINO-5-METHYL-4H-1,2,4-TRIAZOLE Preparation Products And Raw materials |
|