6-Amino-5-nitronicotinic acid manufacturers
|
| | 6-Amino-5-nitronicotinic acid Basic information |
| Product Name: | 6-Amino-5-nitronicotinic acid | | Synonyms: | 6-Amino-5-nitronicotinic acid;6-Amino-5-nitropyridine-3-carboxylic acid;3-Pyridinecarboxylic acid, 6-amino-5-nitro-;6-amino-5-nitro-3-pyridinecarboxylic acid;245-Nitro-6-aminonicotinic acid | | CAS: | 89488-06-2 | | MF: | C6H5N3O4 | | MW: | 183.12 | | EINECS: | | | Product Categories: | | | Mol File: | 89488-06-2.mol |  |
| | 6-Amino-5-nitronicotinic acid Chemical Properties |
| Melting point | 300-301 °C (decomp) | | Boiling point | 435.9±45.0 °C(Predicted) | | density | 1.675±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3.46±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C6H5N3O4/c7-5-4(9(12)13)1-3(2-8-5)6(10)11/h1-2H,(H2,7,8)(H,10,11) | | InChIKey | JDDGLUVPISQPKN-UHFFFAOYSA-N | | SMILES | C1=NC(N)=C([N+]([O-])=O)C=C1C(O)=O |
| | 6-Amino-5-nitronicotinic acid Usage And Synthesis |
| | 6-Amino-5-nitronicotinic acid Preparation Products And Raw materials |
|