|
|
| | 4-(1H-1,2,3-Triazole-1-yl)aniline Basic information |
| Product Name: | 4-(1H-1,2,3-Triazole-1-yl)aniline | | Synonyms: | 1-(4-Aminophenyl)-1H-1,2,3-triazole;4-(1H-1,2,3-Triazole-1-yl)aniline;1-(4-AMINO-PHENYL)-1,2,3-TRIAZOLE;4-(1H-1,2,3-Triazol-1-yl)benzenamine;4-(1H-1,2,3-triazol-1-yl)aniline;Benzenamine, 4-(1H-1,2,3-triazol-1-yl)-;4-(Triazol-1-yl)aniline | | CAS: | 16279-88-2 | | MF: | C8H8N4 | | MW: | 160.18 | | EINECS: | | | Product Categories: | | | Mol File: | 16279-88-2.mol |  |
| | 4-(1H-1,2,3-Triazole-1-yl)aniline Chemical Properties |
| Boiling point | 362.1±44.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 3.44±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H8N4/c9-7-1-3-8(4-2-7)12-6-5-10-11-12/h1-6H,9H2 | | InChIKey | VBRMIWOLUCKNTN-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(N2C=CN=N2)C=C1 |
| | 4-(1H-1,2,3-Triazole-1-yl)aniline Usage And Synthesis |
| | 4-(1H-1,2,3-Triazole-1-yl)aniline Preparation Products And Raw materials |
|