- BOC-PYR-OH
-
- $7.00 / 1kg
-
2019-07-06
- CAS: 53100-44-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100KG
|
| | BOC-PYR-OH Basic information |
| Product Name: | BOC-PYR-OH | | Synonyms: | Boc-L-Pyr-OH*DCHA;N-alpha-t-Butyloxycarbonyl-L-pyroglutamic acid dicyclohexylamine;5-oxo-,1-(1,1-dimethylethyl)ester,(s)-2-pyrrolidinedicarboxylicacid;1-(tert-butyl) hydrogen (S)-5-oxopyrrolidine-1,2-dicarboxylate;(Tert-Butoxy)Carbonyl Pyr-OH;(S)-1-Boc-5-oxopyrrolidine-2-carboxylic acid, 98%;N-ALPHA-T-BUTYLOXYCARBONYL-L-PYROGLUTAMIC ACID;(S)-Boc-5-Oxopyrrolidine-2-carboxylic acid 95+% | | CAS: | 53100-44-0 | | MF: | C10H15NO5 | | MW: | 229.23 | | EINECS: | 258-362-2 | | Product Categories: | Unusual Amino Acids;Boc-Amino acid series | | Mol File: | 53100-44-0.mol |  |
| | BOC-PYR-OH Chemical Properties |
| Melting point | 65-67℃ | | Boiling point | 425.8±38.0 °C(Predicted) | | density | 1.304 | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.04±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]22/D 35.0, c = 1 in chloroform | | Sensitive | Moisture Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H15NO5/c1-10(2,3)16-9(15)11-6(8(13)14)4-5-7(11)12/h6H,4-5H2,1-3H3,(H,13,14)/t6-/m0/s1 | | InChIKey | MJLQPFJGZTYCMH-LURJTMIESA-N | | SMILES | N1(C(OC(C)(C)C)=O)C(=O)CC[C@H]1C(O)=O | | CAS DataBase Reference | 53100-44-0 | | EPA Substance Registry System | 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)- (53100-44-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29337900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | BOC-PYR-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Boc-Pyr-OH can be used as fluorescent probe. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-PYR-OH Preparation Products And Raw materials |
|