|
|
| | 2,3,4,5-Tetrafluorobenzoyl chloride Basic information |
| Product Name: | 2,3,4,5-Tetrafluorobenzoyl chloride | | Synonyms: | 2,3,4,5-TETRAFLUORBENZOYLCHLORID;2,3,4,5-TETRAFLUOROBENZOYL CHLORIDE;Benzoyl chloride, 2,3,4,5-tetrafluoro- (9CI);2,3,4,5-Tetrafluorobenzoyl;2,3,4,5-Tetrafluorobenzoyl chloride 98%;2,3,4,5-TETRAFLUOROBEZOYL CHLORIDE;2,3,4,5-Tetrafluorobenzoylchloride98%;2,3,4,5-Tetrafluorobenzoic acid chloride | | CAS: | 94695-48-4 | | MF: | C7HClF4O | | MW: | 212.53 | | EINECS: | 619-058-9 | | Product Categories: | Acid Halides;Carbonyl Compounds;Organic Building Blocks;API intermediates;ACIDHALIDE;Miscellaneous | | Mol File: | 94695-48-4.mol |  |
| | 2,3,4,5-Tetrafluorobenzoyl chloride Chemical Properties |
| Boiling point | 65-66°C 10mm | | density | 1.58 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4787(lit.) | | Fp | 194 °F | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.580 | | Sensitive | Moisture Sensitive | | BRN | 5266860 | | InChI | InChI=1S/C7HClF4O/c8-7(13)2-1-3(9)5(11)6(12)4(2)10/h1H | | InChIKey | XWCKIXLTBNGIHV-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 94695-48-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-37-36/37 | | Safety Statements | 26-36/37/39-45-25 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2,3,4,5-Tetrafluorobenzoyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 2,3,4,5-Tetrafluorobenzoyl chloride was used in the preparation of 4-hydroxy-1-(3-pyridyl)-1-butanone-tetrafluorobenzoate. It was also used in the synthesis of N-[(4-carbamoylphenyl)carbamothioyl]-2,3,4,5-tetrafluorobenzamide. |
| | 2,3,4,5-Tetrafluorobenzoyl chloride Preparation Products And Raw materials |
|