5-Bromo-4-chloro-3-indolyl-N-acetyl-β-D-glucosaminide manufacturers
|
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-β-D-glucosaminide Basic information |
| Product Name: | 5-Bromo-4-chloro-3-indolyl-N-acetyl-β-D-glucosaminide | | Synonyms: | X-BETA-D-GLCNAC;X-GLUNAC;X-GLCNAC;X-N-ACETYL-GLUCOSAMINIDE;X-N-ACETYL-BETA-D-GLUCOSAMINIDE;N-[(2S,3R,4R,5S,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide;N-((2S,3R,4R,5S,6R)-2-((5-Bromo-4-chloro-1H-indol-3-yl)oxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)acetamide;5-Bromo-4-chloro-3-indolyl-2-acetamido-2-deoxy-β-D-gluctopyranoside | | CAS: | 4264-82-8 | | MF: | C16H18BrClN2O6 | | MW: | 449.68 | | EINECS: | | | Product Categories: | Aromatics;Carbohydrates & Derivatives;Heterocycles;substrate | | Mol File: | 4264-82-8.mol |  |
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-β-D-glucosaminide Chemical Properties |
| Melting point | 240 °C(lit.) | | alpha | [α]D20 -82~-86°(c=0.1,DMF) | | Boiling point | 777.5±60.0 °C(Predicted) | | density | 1.78±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMF: soluble | | pka | 12.87±0.70(Predicted) | | form | powder | | color | White | | InChIKey | SUWPNTKTZYIFQT-OKXUJJAQNA-N | | SMILES | C12C(Cl)=C(C=CC=1NC=C2O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1NC(=O)C)CO)Br |&1:11,13,14,16,18,r| | | CAS DataBase Reference | 4264-82-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 3-8-10 | | HS Code | 29349990 |
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-β-D-glucosaminide Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | Nutrient medium for yeast culture | | Definition | ChEBI: 5-bromo-4-chloro-3-indolyl N-acetyl-beta-D-glucosaminide is an indolyl carbohydrate that is the N-acetyl-beta-D-glucosaminide of indoxyl in which the indole moiety is substituted at positions 4 and 5 by chlorine and bromine, respectively. It has a role as a chromogenic compound. It is an indolyl carbohydrate, a N-acetyl-beta-D-glucosaminide, a bromoindole and a chloroindole. It is functionally related to an indoxyl. |
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-β-D-glucosaminide Preparation Products And Raw materials |
|