|
|
| | 3,6-Dichloro-1,2,4,5-tetrazine Basic information |
| Product Name: | 3,6-Dichloro-1,2,4,5-tetrazine | | Synonyms: | 3,6-Dichloro-1,2,4,5-tetrazine;3,6-Dichloro-s-tetrazine;Dichloro-s-tetrazine;dichloro-1,2,4,5-tetrazine;1,2,4,5-Tetrazine, 3,6-dichloro-;3,6-dichloro-1,2,3,4-tetrazine;3,6-Dichloro-1,2,4,5-tetrazine ISO 9001：2015 REACH;5-tetrazine | | CAS: | 106131-61-7 | | MF: | C2Cl2N4 | | MW: | 150.95 | | EINECS: | | | Product Categories: | | | Mol File: | 106131-61-7.mol |  |
| | 3,6-Dichloro-1,2,4,5-tetrazine Chemical Properties |
| Melting point | 148℃ | | Boiling point | 331.0±25.0 °C(Predicted) | | density | 1.750±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | -5.54±0.10(Predicted) | | color | Orange to red | | InChI | InChI=1S/C2Cl2N4/c3-1-5-7-2(4)8-6-1 | | InChIKey | HXXFMIAFWKZHDY-UHFFFAOYSA-N | | SMILES | N1C(Cl)=NN=C(Cl)N=1 | | CAS DataBase Reference | 106131-61-7 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Self-react. C
Skin Irrit. 2
STOT SE 3 |
| | 3,6-Dichloro-1,2,4,5-tetrazine Usage And Synthesis |
| Uses | 3,6-Dichloro-1,2,4,5-tetrazine was reported in stapling of complex peptides as a photochemical trigger. Professor Amos Smith and coworkers have displayed this application in several recent reports. | | Synthesis | 3,6-Dichloro-1,2,4,5-tetrazine is one of several intermediates that can be prepared from guanidine hydrochloride and metformin in a five-step reaction. 3,6-Dichloro-1,2,4,5-tetrazine can be used to prepare a class of hydrogen sulfide fluorescent probe compounds. Biosulfhydryl compounds are crucial molecules in cells, playing important roles as antioxidants in damage and oxidative stress and interacting with metals as chelators and signaling agents. |
| | 3,6-Dichloro-1,2,4,5-tetrazine Preparation Products And Raw materials |
|