| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Phenol-2,4,6-d3 Basic information |
| Product Name: | Phenol-2,4,6-d3 | | Synonyms: | 2,4,6-Phenol-D3;Phen-2,4,6-D3-ol;PHENOL-2 4 6-D3;PHENOL-2,4,6-D3,OD;PHENOL-2,4,6-D3, 98 ATOM % D;2,4,6-trideuteriophenol;Phenol-2,4,6-d?;Phenol-2,4,6-d3 | | CAS: | 7329-50-2 | | MF: | C6H6O | | MW: | 94.11 | | EINECS: | | | Product Categories: | Alphabetical Listings;P;Stable Isotopes | | Mol File: | 7329-50-2.mol |  |
| | Phenol-2,4,6-d3 Chemical Properties |
| Melting point | 40-42 °C (lit.) | | Boiling point | 182 °C (lit.) | | density | 1.105 g/mL at 25 °C | | Fp | 79 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H/i1D,4D,5D | | InChIKey | ISWSIDIOOBJBQZ-NHPOFCFZSA-N | | SMILES | [2H]c1cc([2H])c(O)c([2H])c1 | | EPA Substance Registry System | 2,4,6-Phenol-d3 (7329-50-2) |
| Hazard Codes | T,C | | Risk Statements | 23/24/25-34-48/20/21/22-68 | | Safety Statements | 24/25-26-28-36/37/39-45 | | RIDADR | UN 1671 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 2
Eye Dam. 1
Muta. 2
Skin Corr. 1B
STOT RE 2 |
| | Phenol-2,4,6-d3 Usage And Synthesis |
| Uses | Phenol-2,4,6-d3 is purified here for molecular genetics applications. It is naturally found in tea leaves and plants, and has uses in the synthesis of antioxidant compounds due to the antioxidant activity caus ed by the phenol moiety. This structure also allows it to be used for syntheses of anti-bacterial & anti-carcinogenic compounds. |
| | Phenol-2,4,6-d3 Preparation Products And Raw materials |
|