| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 4-Ethylphenylamino-1,2-dimethyl-6-methylaminopyrimidinium chloride Basic information |
| | 4-Ethylphenylamino-1,2-dimethyl-6-methylaminopyrimidinium chloride Chemical Properties |
| Boiling point | 359.9±52.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble10mg/mL, clear | | pka | 11.97±0.70(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C15H20N4.ClH.H2O/c1-5-19(13-9-7-6-8-10-13)15-11-14(16-3)18(4)12(2)17-15;;/h6-11H,5H2,1-4H3;1H;1H2/b16-14+;; | | InChIKey | NCEDDDWQLCMZQG-UPONXUSQSA-N | | SMILES | O.Cl.CCN(c1ccccc1)C2=CC(=N/C)\N(C)C(C)=N2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4-Ethylphenylamino-1,2-dimethyl-6-methylaminopyrimidinium chloride Usage And Synthesis |
| Uses | ZD7288 hydrate has been used asIhblocker to study its effect on neocortical tissue. It has been used as hyperpolarization-activated and cyclic nucleotide-gated (HCN)-channel blocker to test the involvement of HCN channels in the phototransduction pathway. | | Biochem/physiol Actions | Selective blocker of cation channel Ih; If blocker and sino-atrial node function modulator, blocks hyperpolarization-activated and cyclic nucleotide-gated (HCN) channels. |
| | 4-Ethylphenylamino-1,2-dimethyl-6-methylaminopyrimidinium chloride Preparation Products And Raw materials |
|