|
|
| | Diethyl 3-hydroxyglutarate Basic information |
| | Diethyl 3-hydroxyglutarate Chemical Properties |
| Boiling point | 156-157 °C/23 mmHg (lit.) | | density | 1.103 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.439(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.60±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | BRN | 1709448 | | InChI | InChI=1S/C9H16O5/c1-3-13-8(11)5-7(10)6-9(12)14-4-2/h7,10H,3-6H2,1-2H3 | | InChIKey | OLLQYIBTJXUEEX-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CC(O)CC(OCC)=O | | CAS DataBase Reference | 32328-03-3(CAS DataBase Reference) | | NIST Chemistry Reference | Diethyl 3-hydroxyglutarate(32328-03-3) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 29181990 | | Storage Class | 10 - Combustible liquids |
| | Diethyl 3-hydroxyglutarate Usage And Synthesis |
| Uses | Diethyl 3-hydroxyglutarate (D3HG) is an important organic compound or pharmaceutical intermediate ingredient. It has antihypercholesterolaemic properties. D3HG can be hydrolysed enzymatically to produce the major enantiomer pure mono ester (3S)-4-carbamoyl-3-hydroxybutanoate ethyl ester. |
| | Diethyl 3-hydroxyglutarate Preparation Products And Raw materials |
|