| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
[R,(-)]-1-O-Phosphono-D-glycerol manufacturers
|
| | [R,(-)]-1-O-Phosphono-D-glycerol Basic information |
| Product Name: | [R,(-)]-1-O-Phosphono-D-glycerol | | Synonyms: | (R)-1,2,3-Propanetriol 1-dihydrogenphosphate;[R,(-)]-1-O-Phosphono-D-glycerol;1-Phospho-D-glyceric acid;D-Glycerol 1-phosphoric acid;sn-Glycerol phosphate;D-Glycerol 1-phosphate lithium salt;L-Glycerol 3-phosphate lithium salt;1,2,3-Propanetriol, 1-(dihydrogen phosphate), (2R)- | | CAS: | 17989-41-2 | | MF: | C3H9O6P | | MW: | 172.07 | | EINECS: | | | Product Categories: | | | Mol File: | 17989-41-2.mol | ![[R,(-)]-1-O-Phosphono-D-glycerol Structure](CAS/GIF/17989-41-2.gif) |
| | [R,(-)]-1-O-Phosphono-D-glycerol Chemical Properties |
| Boiling point | 485.5±55.0 °C(Predicted) | | density | 1.738±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | Solid | | pka | 1.84±0.10(Predicted) | | color | White to off-white | | Optical Rotation | [α]/D +2.0±0.5°°, c = 1 in H2O | | Water Solubility | Water: ≥ 50 mg/mL (290.58 mM) | | InChI | 1S/C3H9O6P/c4-1-3(5)2-9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)/t3-/m1/s1 | | InChIKey | AWUCVROLDVIAJX-GSVOUGTGSA-N | | SMILES | [P](=O)(OC[C@H](O)CO)(O)O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | [R,(-)]-1-O-Phosphono-D-glycerol Usage And Synthesis |
| Definition | ChEBI: An sn-glycerol 3-phosphate having unsubstituted hydroxy groups. | | Biochem/physiol Actions | Metabolite in glycerolipid metabolism and glycerophospholipid metabolism. Ugp-dependent transport system for G3P in E. coli. |
| | [R,(-)]-1-O-Phosphono-D-glycerol Preparation Products And Raw materials |
|