|
|
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-beta-D-galactosaminide Basic information |
| Product Name: | 5-Bromo-4-chloro-3-indolyl-N-acetyl-beta-D-galactosaminide | | Synonyms: | X-GalactosaMidide;5-Bromo-4-chloro-3-indoxyl-N-acetyl-∫-D-galactosaminide;X-N-ACETYL-BETA-D-GALACTOSAMINIDE;X-N-ACETYL-GALACTOSAMINIDE;X-GALNAC;X-BETA-D-GALNAC;5-BROMO-4-CHLORO-3-INDOXYL-N-ACETYL-BETA-D-GALACTOSAMINIDE;5-BROMO-4-CHLORO-3-INDOLYL-N-ACETYL-BETA-D-GALACTOSAMINIDE | | CAS: | 129572-48-1 | | MF: | C16H18BrClN2O6 | | MW: | 449.68 | | EINECS: | 1533716-785-6 | | Product Categories: | substrate | | Mol File: | 129572-48-1.mol |  |
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-beta-D-galactosaminide Chemical Properties |
| Melting point | ≥220 °C(lit.) | | Boiling point | 777.5±60.0 °C(Predicted) | | density | 1.78±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMF: soluble | | form | powder | | pka | 12.87±0.70(Predicted) | | color | Pale Grey to Light Grey | | InChI | InChI=1S/C16H18BrClN2O6/c1-6(22)20-13-15(24)14(23)10(5-21)26-16(13)25-9-4-19-8-3-2-7(17)12(18)11(8)9/h2-4,10,13-16,19,21,23-24H,5H2,1H3,(H,20,22) | | InChIKey | SUWPNTKTZYIFQT-UHFFFAOYSA-N | | SMILES | C(NC1C(O)C(O)C(CO)OC1OC1C2=C(NC=1)C=CC(Br)=C2Cl)(=O)C | | CAS DataBase Reference | 129572-48-1(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 3-8-10 | | HS Code | 29349990 |
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-beta-D-galactosaminide Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 5-Bromo-4-chloro-3-indolyl-N-acetyl-b-D-galactosaminide can be used to detect micro-organism using microfluidic paper chip. |
| | 5-Bromo-4-chloro-3-indolyl-N-acetyl-beta-D-galactosaminide Preparation Products And Raw materials |
|