|
|
| | tert-Butyl (2S,3R)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate Basic information |
| Product Name: | tert-Butyl (2S,3R)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate | | Synonyms: | (2S,3R)-6-Oxo-2,3-diphenyl-morpholine-4-carboxylic acid tert-butyl ester;(5S,6R)-(+)-4-Boc-5,6-diphenyl-2-Morpholinone, 99%;(2S,3R)-(+)-N-Boc-6-oxo-2,3-diphenylMorpholine;(5R,6S)-N-Boc-5,6-diphenyl-2-morpholinone;(2S,3R)-(+)-N-Boc-6-oxo-2,3-diphenylMorpholine;(2S, 3R) - (+) - N- t-butoxycarbonyl-6-oxo-2,3-diphenyl-Morpholine;(2S,3R)-tert-Butyl;6-oxo-2,3-diphenylMorpholine-4-carboxylate | | CAS: | 112741-50-1 | | MF: | C21H23NO4 | | MW: | 353.41 | | EINECS: | 627-150-5 | | Product Categories: | Chiral Building Blocks;Heterocyclic Building Blocks;Morpholines;API intermediates | | Mol File: | 112741-50-1.mol |  |
| | tert-Butyl (2S,3R)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate Chemical Properties |
| Melting point | 206 °C (dec.)(lit.) | | Boiling point | 509.6±50.0 °C(Predicted) | | alpha | 86 º (c=5.5 in methylene chloride) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in THF, CH2Cl2 | | form | solid | | pka | -3.28±0.60(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +86°, c = 5.5 in methylene chloride | | InChI | InChI=1S/C21H23NO4/c1-21(2,3)26-20(24)22-14-17(23)25-19(16-12-8-5-9-13-16)18(22)15-10-6-4-7-11-15/h4-13,18-19H,14H2,1-3H3/t18-,19+/m1/s1 | | InChIKey | MRUKRSQUUNYOFK-MOPGFXCFSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(=O)O[C@@H](C2=CC=CC=C2)[C@H]1C1=CC=CC=C1 | | CAS DataBase Reference | 112741-50-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | tert-Butyl (2S,3R)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate Usage And Synthesis |
| Uses | (2S,3R)-(+)-N-Boc-6-oxo-2,3-diphenylmorpholine (Williams chiral auxiliary) can be used as a reactant:
- In the asymmetric synthesis of cylindrospermopsin and related alkaloids via an intramolecular 1,3-dipolar cycloaddition reaction.
- To synthesize boc-3-(1-methylcyclopropyl)-D-alanine, which is used as an intermediate to prepare 4-fluoroproline-based analogs as potent tripeptide thrombin inhibitors.
- In the total synthesis of potent hepatotoxic alkaloid 7-epicylindrospermopsin by intramolecular 1,3-dipolar cycloaddition and nitroaldol reaction.
- To prepare differentially functionalized diaminoglutamic acids via radical reaction of selenide with methyl 2-acetamidoacrylate.
| | Synthesis | Tert-Butyl (2S,3R)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate could be synthesize via a three-step procedure from erythro-2-amino-1,2-diphenylethanol
|
| | tert-Butyl (2S,3R)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate Preparation Products And Raw materials |
|