|
|
| | 6-Methoxy-2-(4-methoxyphenyl)benzobithiophene Basic information |
| | 6-Methoxy-2-(4-methoxyphenyl)benzobithiophene Chemical Properties |
| Melting point | 191-197 °C(lit.) | | Boiling point | 435.7±35.0 °C(Predicted) | | density | 1.194±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C16H14O2S/c1-17-13-6-3-11(4-7-13)15-9-12-5-8-14(18-2)10-16(12)19-15/h3-10H,1-2H3 | | InChIKey | HRWAGCVMOGWQJF-UHFFFAOYSA-N | | SMILES | C12=CC(OC)=CC=C1C=C(C1=CC=C(OC)C=C1)S2 | | CAS DataBase Reference | 63675-74-1(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2934.99.4400 | | Storage Class | 11 - Combustible Solids |
| | 6-Methoxy-2-(4-methoxyphenyl)benzobithiophene Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Reactant for: Preparation of biologically and pharmacologically active molecules | | Uses | Intermediate in the production of Reloxifene impurities |
| | 6-Methoxy-2-(4-methoxyphenyl)benzobithiophene Preparation Products And Raw materials |
|