|
|
| | Phenazine-1-carboxylic acid Basic information |
| | Phenazine-1-carboxylic acid Chemical Properties |
| Melting point | 242-244℃ | | Boiling point | 494.6±10.0 °C(Predicted) | | density | 1.431±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | pka | 2.15±0.30(Predicted) | | form | Solid | | color | Brown to Orange-Brown | | InChI | InChI=1S/C13H8N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H,(H,16,17) | | InChIKey | JGCSKOVQDXEQHI-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)C2C(=NC3C(N=2)=CC=CC=3)C=CC=1 |
| Hazard Codes | Xi | | HS Code | 2917399590 | | Toxicity | LD50 intraperitoneal in mouse: 400mg/kg |
| | Phenazine-1-carboxylic acid Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Tubermycin B (1-phenazinecarboxylic acid) is a simple phenazine produced by several species of Pseudomonas and Actinomycetes. Tubermycin B is a weakly active antibacterial compound that plays a role in the biocontrol of plant diseases by several Pseudomonas strains. Tubermycin B and related phenazines are important dereplication standards in discovery research to eliminate leads due to high amounts of weakly potent actives. | | Uses | A microorganism based antimicrobial with high efficiency, low toxicity and good environmental compatibility. A key effective component of the pesticide M18. | | Definition | ChEBI: An aromatic carboxylic acid that is phenazine substituted at C-1 with a carboxy group. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 43, p. 1350, 2000 DOI: 10.1021/jm990423f | | in vivo | Phenazine-1-carboxylic acid (2 and 3 μg/mL, added through E3 medium, single dose) significantly prevented V. anguillaruminfection in zebrafish embryos[4]. | Animal Model: | Zebrafish embryos infected with Vibrio anguillarum[4] | | Dosage: | 2 μg/mL and 3 μg/mL | | Administration: | Added through zebrafish embryo E3 medium, single dose | | Result: | Effectively inhibited V. anguillarum infection in zebrafish embryos and increased embryo hatching rate. |
|
| | Phenazine-1-carboxylic acid Preparation Products And Raw materials |
|