- DMAE
-
- $20.70 / 1KG
-
2025-05-26
- CAS:5988-51-2
- Min. Order: 10KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 2-Dimethylaminoethanol (+)-bitartrate salt Basic information |
| Product Name: | 2-Dimethylaminoethanol (+)-bitartrate salt | | Synonyms: | 2-DIMETHYLAMINOETHANOL L-HYDROGENTARTRATE;DEANOL BITARTRATE;DMAE BITARTRATE;DIMETHYL AMINO ETHYL BITARTRATE;ATROL;N,N-DIMETHYLETHANOLAMINE L-HYDROGENTARTRATE;Atrol, N,N-Dimethylethanolamine (+)-bitartrate salt;N,N-Dimethylethanolamine (+)-bitartrate salt | | CAS: | 5988-51-2 | | MF: | C8H17NO7 | | MW: | 239.22 | | EINECS: | 227-809-3 | | Product Categories: | | | Mol File: | 5988-51-2.mol |  |
| | 2-Dimethylaminoethanol (+)-bitartrate salt Chemical Properties |
| Melting point | 109-113 °C | | alpha | 18 º (C=3% IN H2O) | | storage temp. | Refrigerator | | solubility | Methanol (Slightly, Heated), Water (Slightly) | | form | Solid | | color | White | | Optical Rotation | [α]20/D +18±1°, c = 3% in H2O | | Merck | 13,2863 | | Major Application | peptide synthesis | | Cosmetics Ingredients Functions | SKIN CONDITIONING
SKIN CONDITIONING - EMOLLIENT | | InChI | 1S/C4H11NO.C4H6O6/c1-5(2)3-4-6;5-1(3(7)8)2(6)4(9)10/h6H,3-4H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 | | InChIKey | UIEGYKVRCKDVKQ-LREBCSMRSA-N | | SMILES | CN(C)CCO.O[C@H]([C@@H](O)C(O)=O)C(O)=O | | CAS DataBase Reference | 5988-51-2(CAS DataBase Reference) | | EPA Substance Registry System | Ethanol, 2-(dimethylamino)-, (2R,3R)-2,3-dihydroxybutanedioate (1:1) (salt) (5988-51-2) |
| WGK Germany | 2 | | RTECS | KK7175000 | | F | 3-10 | | HS Code | 2922.50.5000 | | Storage Class | 11 - Combustible Solids |
| | 2-Dimethylaminoethanol (+)-bitartrate salt Usage And Synthesis |
| Uses | 2-Dimethylaminoethanol Bitartrate is used in biological studies to evaluate motor activity in response to the injection of 2-dimethylaminoethanol. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-Dimethylaminoethanol (+)-bitartrate salt Preparation Products And Raw materials |
|