- Nicotinylmethylamide
-
- $1.00 / 1Kg
-
2024-07-20
- CAS:3569-99-1
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | 3-Pyridinecarboxylic acid N-hydroxymethylamide Basic information |
| | 3-Pyridinecarboxylic acid N-hydroxymethylamide Chemical Properties |
| Melting point | 152-154 °C (lit.) | | Boiling point | 427.7±25.0 °C(Predicted) | | density | 1.262±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO, Methanol | | pka | 12.22±0.46(Predicted) | | form | Solid | | color | White | | Merck | 14,4833 | | InChI | InChI=1S/C7H8N2O2/c10-5-9-7(11)6-2-1-3-8-4-6/h1-4,10H,5H2,(H,9,11) | | InChIKey | JRFKIOFLCXKVOT-UHFFFAOYSA-N | | SMILES | C1=NC=CC=C1C(NCO)=O | | CAS DataBase Reference | 3569-99-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | QS4476500 | | HS Code | 2933.39.9200 |
| | 3-Pyridinecarboxylic acid N-hydroxymethylamide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A decomposition product found in the preparation of Nicotinic acid. | | Uses | 3-Pyridinecarboxylic acid N-hydroxymethylamide is used as a cholagogue agen. | | Definition | ChEBI: Hydroxymethylnicotinamide is a pyridinecarboxamide. It is functionally related to a nicotinamide. | | General Description | A quantitative determination of N-(hydroxymethyl)nicotinamide in tablets and basic solutions along with nicotinic acid by thin-layer chromatography-densitometric method has been reported. N-(Hydroxymethyl)nicotinamide is an antimicrobial agent. |
| | 3-Pyridinecarboxylic acid N-hydroxymethylamide Preparation Products And Raw materials |
|