|
|
| | 7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-one Basic information |
| Product Name: | 7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-one | | Synonyms: | 7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-one;7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-yl]oxy]-2H-1-benzopyran-2-one;umbelliprenine;2H-1-Benzopyran-2-one, 7-[[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]oxy]-;7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-oneUmbelliprenin;7-(((2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl)oxy)-2H-chromen-2-one;Umbelliprenin, 10 mM in DMSO;Umbelliprenin | | CAS: | 23838-17-7 | | MF: | C24H30O3 | | MW: | 366.49 | | EINECS: | | | Product Categories: | | | Mol File: | 23838-17-7.mol | ![7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-one Structure](CAS/GIF/23838-17-7.gif) |
| | 7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-one Chemical Properties |
| Melting point | 61-63 °C(Solv: ethyl ether (60-29-7); ligroine (8032-32-4)) | | Boiling point | 512.6±50.0 °C(Predicted) | | density | 1.039 | | storage temp. | -20°C | | solubility | water: slightly soluble | | form | Solid | | color | White to off-white | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | 1S/C24H30O3/c1-18(2)7-5-8-19(3)9-6-10-20(4)15-16-26-22-13-11-21-12-14-24(25)27-23(21)17-22/h7,9,11-15,17H,5-6,8,10,16H2,1-4H3/b19-9+,20-15+ | | InChIKey | GNMUGVNEWCZUAA-WOWYBKFKSA-N | | SMILES | [o]1c2c(cc[c]1=O)ccc(c2)OC\C=C(\CC\C=C(\CCC=C(C)C)/C)/C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-one Usage And Synthesis |
| Uses | Umbelliprenin is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Definition | ChEBI: Umbelliprenin is a terpene lactone. | | Biological Activity | Umbelliprenin might be valuable as a cancer chemopreventive agent. | | in vivo | Umbelliprenin (6.25-25 mg/kg; ip; once) alleviates neuropathic pain, and decreased serum IL-6 levels and oxidative stress[1]. | Animal Model: | Male albino mice (30-35 g; 4 weeks old) injected with Paclitaxel (2 mg/kg)[1] | | Dosage: | 6.25, 12.5 and 25 mg/kg | | Administration: | ip; once | | Result: | Effectively attenuated hyperalgesia, lipid peroxidation and IL-6 levels. |
|
| | 7-[[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl]oxy]-2H-1-benzopyran-2-one Preparation Products And Raw materials |
|