Methyl 5-nitro-2-pyridinecarboxylate manufacturers
|
| | Methyl 5-nitro-2-pyridinecarboxylate Basic information |
| Product Name: | Methyl 5-nitro-2-pyridinecarboxylate | | Synonyms: | 5-Nitro-2-pyridinecarboxylic acid methyl ester;Methyl 5-nitro-2-pyridinecarboxylate;Methyl 5-nitro-pyridine-2-carboxylate;5-Nitropyridine-2-carboxylic acid methyl ester;Methyl 5-nitropicolinate;2-Pyridinecarboxylic acid, 5-nitro-, Methyl ester;Methyl 5-nitro-2-pyridinecarboxylate ISO 9001：2015 REACH | | CAS: | 29682-14-2 | | MF: | C7H6N2O4 | | MW: | 182.13 | | EINECS: | | | Product Categories: | | | Mol File: | 29682-14-2.mol |  |
| | Methyl 5-nitro-2-pyridinecarboxylate Chemical Properties |
| Melting point | 150-153 °C | | Boiling point | 340.2±27.0 °C(Predicted) | | density | 1.375±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -2.34±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H6N2O4/c1-13-7(10)6-3-2-5(4-8-6)9(11)12/h2-4H,1H3 | | InChIKey | WBJDJRHSHXTRAT-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC=C([N+]([O-])=O)C=C1 |
| | Methyl 5-nitro-2-pyridinecarboxylate Usage And Synthesis |
| Uses | Methyl 5-Nitropicolinate is an intermediate used to prepare 5-thio-2-pyridinecarboxylic acid derivatives with antihypertensive activities. |
| | Methyl 5-nitro-2-pyridinecarboxylate Preparation Products And Raw materials |
|