2-Bromo-3-methoxynaphthalene manufacturers
- 2-Bromo-3-methoxynaphthalene
-
- $200.00 / 1KG
-
2025-09-25
- CAS:68251-77-4
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Bromo-3-methoxynaphthalene Basic information |
| Product Name: | 2-Bromo-3-methoxynaphthalene | | Synonyms: | 2-Bromo-3-methoxynaphthalene;2-Bromo-3-methoxynaphthalene >;Naphthalene, 2-bromo-3-methoxy-;2-Bromo-3-methoxynaphthalene ISO 9001：2015 REACH | | CAS: | 68251-77-4 | | MF: | C11H9BrO | | MW: | 237.09 | | EINECS: | | | Product Categories: | | | Mol File: | 68251-77-4.mol |  |
| | 2-Bromo-3-methoxynaphthalene Chemical Properties |
| Melting point | 69-71 °C | | Boiling point | 319.2±15.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C11H9BrO/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12/h2-7H,1H3 | | InChIKey | VFAPZPJQVMNTEX-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC(OC)=C1Br | | CAS DataBase Reference | 68251-77-4 |
| | 2-Bromo-3-methoxynaphthalene Usage And Synthesis |
| Uses | 2-Bromo-3-methoxynaphthalene is used as a reactant in the Pd-catalyzed dimerization of aryl halides to give biaryl compounds. |
| | 2-Bromo-3-methoxynaphthalene Preparation Products And Raw materials |
|