| Company Name: |
Tcichem, Inc. |
| Tel: |
13918644899 |
| Email: |
81587635@qq.com |
|
| | 2-(3-Bromophenyl)-2-methylpropanoic acid Basic information |
| | 2-(3-Bromophenyl)-2-methylpropanoic acid Chemical Properties |
| Boiling point | 413.9±47.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 4.41±0.10(Predicted) | | InChI | 1S/C10H11BrO2/c1-10(2,9(12)13)7-4-3-5-8(11)6-7/h3-6H,1-2H3,(H,12,13) | | InChIKey | PZQVCFYGWRPVLE-UHFFFAOYSA-N | | SMILES | O=C(O)C(C)(C)C1=CC(Br)=CC=C1 |
| WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(3-Bromophenyl)-2-methylpropanoic acid Usage And Synthesis |
| | 2-(3-Bromophenyl)-2-methylpropanoic acid Preparation Products And Raw materials |
|