| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 2-(2-Aminopyrimidin-4-yl)-4-methylphenol Basic information |
| | 2-(2-Aminopyrimidin-4-yl)-4-methylphenol Chemical Properties |
| form | solid | | InChI | 1S/C11H11N3O/c1-7-2-3-10(15)8(6-7)9-4-5-13-11(12)14-9/h2-6,15H,1H3,(H2,12,13,14) | | InChIKey | PLBFXGOPDFUSMM-UHFFFAOYSA-N | | SMILES | NC1=NC(C2=C(O)C=CC(C)=C2)=CC=N1 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 2-(2-Aminopyrimidin-4-yl)-4-methylphenol Usage And Synthesis |
| | 2-(2-Aminopyrimidin-4-yl)-4-methylphenol Preparation Products And Raw materials |
|