|
|
| | 3-Acetyl-5-chlorothiophene-2-sulfonamide Basic information |
| Product Name: | 3-Acetyl-5-chlorothiophene-2-sulfonamide | | Synonyms: | 3-Acetyl-5-chlorothiophene-2-sulfonamide;3-Acetyl-2-(aMinosulfonyl)-5-chlorothiophene;2-Thiophenesulfonamide, 3-Acetyl-5-Chloro-;2-Thiophenesulfonamide,3-Acetyl-5-Chloro-;3-Acetyl-2-(aminosulfonyl)-5-chlorothiophene>;3-Acetyl-5-chloro-2-thiophenesulfonamide(For export only);Metomidine hydrochloride;3-Acetyl-5-Chlorothiophene-2-sulfonylAmide | | CAS: | 160982-10-5 | | MF: | C6H6ClNO3S2 | | MW: | 239.7 | | EINECS: | 605-240-5 | | Product Categories: | | | Mol File: | 160982-10-5.mol |  |
| | 3-Acetyl-5-chlorothiophene-2-sulfonamide Chemical Properties |
| Melting point | 182 °C(dec.) | | Boiling point | 453.0±55.0 °C(Predicted) | | density | 1.583 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 9.29±0.60(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C6H6ClNO3S2/c1-3(9)4-2-5(7)12-6(4)13(8,10)11/h2H,1H3,(H2,8,10,11) | | InChIKey | ODLFFSHLXVZFPY-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)SC(Cl)=CC=1C(C)=O | | CAS DataBase Reference | 160982-10-5 |
| | 3-Acetyl-5-chlorothiophene-2-sulfonamide Usage And Synthesis |
| Chemical Properties | Off-white Solid | | Uses | 3-Acetyl-5-chlorothiophene-2-sulfonamide is a reactant used in the preparation of heteroaryl chalcones as potent antimicrobial agents and Brinzolamide (B677600), a topical carbonic anhydrase inhibitors. |
| | 3-Acetyl-5-chlorothiophene-2-sulfonamide Preparation Products And Raw materials |
|