|
|
| | 3,5-Diaminobenzotrifluoride Basic information |
| | 3,5-Diaminobenzotrifluoride Chemical Properties |
| Melting point | 87-89 °C(lit.) | | Boiling point | 275.0±40.0 °C(Predicted) | | density | 1.2773 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.66±0.10(Predicted) | | color | Brown | | BRN | 2966748 | | InChI | InChI=1S/C7H7F3N2/c8-7(9,10)4-1-5(11)3-6(12)2-4/h1-3H,11-12H2 | | InChIKey | KZSXRDLXTFEHJM-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C(F)(F)F)=CC(N)=C1 | | CAS DataBase Reference | 368-53-6(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Benzeneamine, 5-[(trifluoromethyl)- (368-53-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | RTECS | CZ1606000 | | Hazard Note | Irritant | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HazardClass | 6.1 | | HS Code | 2921511990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 3,5-Diaminobenzotrifluoride Usage And Synthesis |
| Uses | 5-(Trifluoromethyl)-1,3-phenylenediamine was used in the synthesis of:
- hybrid materials based on new polyhedral oligomeric silsesquioxane
- fluorinated aromatic polyimide films
| | Application | 3,5-Diaminotrifluorotoluene is primarily used as a functional monomer in the synthesis of various high-performance materials, especially polymers. A series of fluorinated polyimides can be prepared through polycondensation reactions with various dianhydrides (such as pyromellitic dianhydride). |
| | 3,5-Diaminobenzotrifluoride Preparation Products And Raw materials |
|