| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2,9-Diphenyl-1,10-phenanthroline manufacturers
|
| | 2,9-Diphenyl-1,10-phenanthroline Basic information | | Uses |
| | 2,9-Diphenyl-1,10-phenanthroline Chemical Properties |
| Melting point | 186.0 to 190.0 °C | | Boiling point | 559.5±45.0 °C(Predicted) | | density | 1.210±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.82±0.30(Predicted) | | color | White to Yellow | | InChI | InChI=1S/C24H16N2/c1-3-7-17(8-4-1)21-15-13-19-11-12-20-14-16-22(18-9-5-2-6-10-18)26-24(20)23(19)25-21/h1-16H | | InChIKey | HVCVRVKEIKXBIF-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=C(C2=CC=CC=C2)C=C3)C=CC=1C1=CC=CC=C1 | | CAS DataBase Reference | 25677-69-4 |
| | 2,9-Diphenyl-1,10-phenanthroline Usage And Synthesis |
| Uses | 2,9-Diphenyl-1,10-phenanthroline is a heterocyclic derivative that can be used as an organic intermediate. |
| | 2,9-Diphenyl-1,10-phenanthroline Preparation Products And Raw materials |
|