- 2,5-Difluorobenzyl bromide
-
- $100.00 / 1KG
-
2025-09-25
- CAS:85117-99-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2,5-Difluorobenzyl bromide
-
- $15.00 / 1KG
-
2021-08-12
- CAS:85117-99-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2,5-Difluorobenzyl bromide Basic information |
| Product Name: | 2,5-Difluorobenzyl bromide | | Synonyms: | ALPHA-BROMO-2,5-DIFLUOROTOLUENE;2,5-DIFLUOROBENZYL BROMIDE;2-(Bromomethyl)-1,4-difluorobenzene;Benzene, 2-(bromomethyl)-1,4-difluoro-;TIMTEC-BB SBB006680;à-bromo-2,5-difluorotoluene;α-bromo-2,5-difluorotoluene;2,5-Difluorobenzyl bromide 98% | | CAS: | 85117-99-3 | | MF: | C7H5BrF2 | | MW: | 207.02 | | EINECS: | 285-651-0 | | Product Categories: | Benzhydrols, Benzyl & Special Alcohols;Fluoro-contained benzyl bromide series;Fluorine series;Miscellaneous;Fluorinated benzene series | | Mol File: | 85117-99-3.mol |  |
| | 2,5-Difluorobenzyl bromide Chemical Properties |
| Boiling point | 28 °C | | density | 1.609 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.526(lit.) | | Fp | 60 °F | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Specific Gravity | 1.6090 | | BRN | 7089248 | | InChI | InChI=1S/C7H5BrF2/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 | | InChIKey | ONWGSWNHQZYCFK-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(F)C=C1CBr | | CAS DataBase Reference | 85117-99-3(CAS DataBase Reference) | | NIST Chemistry Reference | 2,5-Difluorobenzyl bromide(85117-99-3) |
| Hazard Codes | F,C,Xi | | Risk Statements | 11-34-22-36 | | Safety Statements | 26-36/37/39-45-16 | | RIDADR | UN 2924 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2
Skin Corr. 1B |
| | 2,5-Difluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW LIQUID | | Uses | 2,5-Difluorobenzyl bromide has been used in the synthesis of:
- novel series of 4-aryl, 4-phenylsulfonyl cyclohexananone-derived γ-secretase inhibitors, for the potential treatment of Alzheimer′s disease
- sulfonamide, amide and acyclic amine derivatives
|
| | 2,5-Difluorobenzyl bromide Preparation Products And Raw materials |
|