| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:5-Bromopyridin-3-yl tert-butyl carbonate CAS:1087659-21-9 Purity:>=95% Package:250mg Remarks:Y20045
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:5-Bromopyridin-3-yltert-butylcarbonate CAS:1087659-21-9 Purity:NULL Package:100mg;250mg;25mg;50mg Remarks:NULL
|
| Company Name: |
Shanghai Aladdin Biochemical Technology Co.,Ltd.
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:5-Bromopyridin-3-yl tert-butyl carbonate CAS:1087659-21-9 Purity:95% Package:100mg/RMB 799.90;250mg/RMB 1399.90
|
|
| | 5-Bromopyridin-3-yl tert-butyl carbonate Basic information |
| | 5-Bromopyridin-3-yl tert-butyl carbonate Chemical Properties |
| Boiling point | 319.8±42.0 °C(Predicted) | | density | 1.424±0.06 g/cm3(Predicted) | | form | solid | | pka | 1.19±0.10(Predicted) | | InChI | 1S/C10H12BrNO3/c1-10(2,3)15-9(13)14-8-4-7(11)5-12-6-8/h4-6H,1-3H3 | | InChIKey | PTJSDWLLHABFKV-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Oc1cncc(Br)c1 |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 5-Bromopyridin-3-yl tert-butyl carbonate Usage And Synthesis |
| | 5-Bromopyridin-3-yl tert-butyl carbonate Preparation Products And Raw materials |
|