| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 5-Bromopyridin-3-yl tert-butyl carbonate Basic information |
| | 5-Bromopyridin-3-yl tert-butyl carbonate Chemical Properties |
| Boiling point | 319.8±42.0 °C(Predicted) | | density | 1.424±0.06 g/cm3(Predicted) | | form | solid | | pka | 1.19±0.10(Predicted) | | InChI | 1S/C10H12BrNO3/c1-10(2,3)15-9(13)14-8-4-7(11)5-12-6-8/h4-6H,1-3H3 | | InChIKey | PTJSDWLLHABFKV-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Oc1cncc(Br)c1 |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 5-Bromopyridin-3-yl tert-butyl carbonate Usage And Synthesis |
| | 5-Bromopyridin-3-yl tert-butyl carbonate Preparation Products And Raw materials |
|