|
|
| | 2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione Basic information |
| Product Name: | 2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione | | Synonyms: | 1,4-Naphthalenedione, 2-methyl-3-(3,7,11,15-tetramethylhexadecyl)-;2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione;beta,gamma-Dihydro Vitamin K1;Phytonadione Impurity 6;2-methyl-3-(3,7,11,15-tetramethylhexadecyl)naphthalene-1,4-dione;β,γ-Dihydro Vitamin K1;Vitamin K1 Impurity 75;2',3'-dihydrophytomenadione | | CAS: | 64236-23-3 | | MF: | C31H48O2 | | MW: | 452.71 | | EINECS: | | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 64236-23-3.mol |  |
| | 2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione Chemical Properties |
| Boiling point | 543.8±50.0 °C(Predicted) | | density | 0.953±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C31H48O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-19,22-25H,9-17,20-21H2,1-6H3 | | InChIKey | XOQNYHSBHIIJMQ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)=C1C |
| | 2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione Usage And Synthesis |
| Uses | Vitamin K1 derivative; a compound formed during hydrogenation of oils containing Vitamin K1. |
| | 2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione Preparation Products And Raw materials |
|